Benzenesulfonic acid,3-nitro-, 4-(1-methylethyl)phenyl ester structure
|
Common Name | Benzenesulfonic acid,3-nitro-, 4-(1-methylethyl)phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 25238-15-7 | Molecular Weight | 321.34800 | |
| Density | 1.311g/cm3 | Boiling Point | 467.3ºC at 760mmHg | |
| Molecular Formula | C15H15NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.4ºC | |
| Name | (4-propan-2-ylphenyl) 3-nitrobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.311g/cm3 |
|---|---|
| Boiling Point | 467.3ºC at 760mmHg |
| Molecular Formula | C15H15NO5S |
| Molecular Weight | 321.34800 |
| Flash Point | 236.4ºC |
| Exact Mass | 321.06700 |
| PSA | 97.57000 |
| LogP | 5.08990 |
| Vapour Pressure | 1.85E-08mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | VFJZEFREJOAXDO-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(OS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1 |
|
~%
Benzenesulfonic... CAS#:25238-15-7 |
| Literature: Dannley,R.L. et al. Journal of Organic Chemistry, 1970 , vol. 35, # 9 p. 3076 - 3079 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-Isopropylphenyl-m-nitrobenzolsulfonat |
| 4-(propan-2-yl)phenyl 3-nitrobenzenesulfonate |