2,2,3,3,4,4-Hexafluoro-1,5-diphenyl-1,5-pentanedione structure
|
Common Name | 2,2,3,3,4,4-Hexafluoro-1,5-diphenyl-1,5-pentanedione | ||
|---|---|---|---|---|
| CAS Number | 2525-83-9 | Molecular Weight | 360.25100 | |
| Density | 1.371g/cm3 | Boiling Point | 392.7ºC at 760 mmHg | |
| Molecular Formula | C17H10F6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.7ºC | |
| Name | 2,2,3,3,4,4-hexafluoro-1,5-diphenylpentane-1,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.371g/cm3 |
|---|---|
| Boiling Point | 392.7ºC at 760 mmHg |
| Molecular Formula | C17H10F6O2 |
| Molecular Weight | 360.25100 |
| Flash Point | 149.7ºC |
| Exact Mass | 360.05800 |
| PSA | 34.14000 |
| LogP | 4.65810 |
| Vapour Pressure | 2.24E-06mmHg at 25°C |
| Index of Refraction | 1.49 |
| InChIKey | CGVZHKUUFCLZHQ-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(=O)c1ccccc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,5-Diphenyl-2,2,3,3,4,4-hexafluoropentane-1,5-dione |
| 1,1,2,2,3,3-Hexafluor-1,3-dibenzoyl-propan |
| Propane,1,3-benzoyl |
| 1,5-Pentanedione,2,2,3,3,4,4-hexafluoro-N,5-diphenyl |
| 1,5-Pentanedione,N,5-diphenyl-2,2,3,3,4,4-hexafluoro |