tert-butyl prop-2-enoate,ethene,prop-2-enoic acid structure
|
Common Name | tert-butyl prop-2-enoate,ethene,prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 25266-67-5 | Molecular Weight | 228.28500 | |
| Density | N/A | Boiling Point | 133ºC at 760 mmHg | |
| Molecular Formula | C12H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 31.6ºC | |
| Name | tert-butyl prop-2-enoate,ethene,prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 133ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.28500 |
| Flash Point | 31.6ºC |
| Exact Mass | 228.13600 |
| PSA | 63.60000 |
| LogP | 2.57330 |
| Vapour Pressure | 8.64mmHg at 25°C |
| InChIKey | WCVLVFBLZSKUQP-UHFFFAOYSA-N |
| SMILES | C=C.C=CC(=O)O.C=CC(=O)OC(C)(C)C |
| 2-Propenoic acid,polymer with 1,1-dimethylethyl 2-propenoate and ethene |