Benzoic acid,4-[methyl[(phenylmethoxy)carbonyl]amino]- structure
|
Common Name | Benzoic acid,4-[methyl[(phenylmethoxy)carbonyl]amino]- | ||
|---|---|---|---|---|
| CAS Number | 2528-30-5 | Molecular Weight | 285.29500 | |
| Density | 1.292g/cm3 | Boiling Point | 473.1ºC at 760mmHg | |
| Molecular Formula | C16H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.9ºC | |
| Name | 4-[methyl(phenylmethoxycarbonyl)amino]benzoic acid |
|---|
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 473.1ºC at 760mmHg |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.29500 |
| Flash Point | 239.9ºC |
| Exact Mass | 285.10000 |
| PSA | 66.84000 |
| LogP | 3.15780 |
| Vapour Pressure | 9.35E-10mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | DJRQNWWJEOPZKC-UHFFFAOYSA-N |
| SMILES | CN(C(=O)OCc1ccccc1)c1ccc(C(=O)O)cc1 |
|
~83%
Benzoic acid,4-... CAS#:2528-30-5 |
| Literature: Piper; Montgomery; Sirotnak; Chello Journal of Medicinal Chemistry, 1982 , vol. 25, # 2 p. 182 - 187 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |