Methyl (R)-1-Boc-piperazine-2-carboxylate structure
|
Common Name | Methyl (R)-1-Boc-piperazine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 252990-05-9 | Molecular Weight | 244.288 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 321.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C11H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.1±26.5 °C | |
| Name | 1-O-tert-butyl 2-O-methyl (2R)-piperazine-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 321.3±37.0 °C at 760 mmHg |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.288 |
| Flash Point | 148.1±26.5 °C |
| Exact Mass | 244.142303 |
| PSA | 67.87000 |
| LogP | 0.73 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.472 |
| InChIKey | BRXKHIPPSTYCKO-MRVPVSSYSA-N |
| SMILES | COC(=O)C1CNCCN1C(=O)OC(C)(C)C |
| HS Code | 2933599090 |
|---|
|
~47%
Methyl (R)-1-Bo... CAS#:252990-05-9 |
| Literature: ASTRAZENECA AB; ASTRAZENECA UK LIMITED Patent: WO2005/26152 A1, 2005 ; Location in patent: Page/Page column 136 ; WO 2005/026152 A1 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 1-N-Boc-(R)-(+)-piperazine-2-carboxylate |
| MFCD04115327 |
| (R)-Piperazine-1,2-dicarboxylic acid 1-tert-butyl ester 2-methyl ester |
| 1,2-Piperazinedicarboxylic acid, 1-(1,1-dimethylethyl) 2-methyl ester, (2R)- |
| (R)-1-N-Boc-piperazine-2-carboxylic acid methyl ester |
| (r)-1-tert-butyl 2-methyl piperazine-1,2-dicarboxylate |
| (R)-N-Boc-piperazine-2-carboxylic acid methyl ester |
| 1,2-Piperazinedicarboxylic acid, 1-(1,1-dimethylethyl) 2-methyl ester |
| 1-tert-butyl 2-methyl-(2R)-piperazine-1,2-dicarboxylate |
| 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperazinedicarboxylate |
| N-boc-piperazine-2-carboxylic acid methyl ester |
| 1-tert-Butyl 2-methyl piperazine-1,2-dicarboxylate |
| 1-tert-Butyl-2-methylpiperazin-1,2-dicarboxylat |
| 2-Methyl 1-(2-methyl-2-propanyl) (2R)-1,2-piperazinedicarboxylate |
| Methyl (R)-1-Boc-piperazine-2-carboxylate |