Benzenesulfonamide,N-(phenylsulfonyl)-, sodium salt (1:1)
Benzenesulfonamide,N-(phenylsulfonyl)-, sodium salt (1:1) structure
|
Common Name | Benzenesulfonamide,N-(phenylsulfonyl)-, sodium salt (1:1) | ||
|---|---|---|---|---|
| CAS Number | 2532-07-2 | Molecular Weight | 319.3 | |
| Density | N/A | Boiling Point | 480.6ºC at 760mmHg | |
| Molecular Formula | C12H10NNaO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | sodium,N-(benzenesulfonyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 480.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H10NNaO4S2 |
| Molecular Weight | 319.3 |
| Flash Point | 244.5ºC |
| Exact Mass | 318.99489443 |
| PSA | 97.07000 |
| LogP | 3.90630 |
| Vapour Pressure | 2.13E-09mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | OUDIZSXRGGGZNM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)[N-]S(=O)(=O)C2=CC=CC=C2.[Na+] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:94500-78-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| sodium dibenzenesulfonimide |
| N-Phenylsulfonyl-N-sodiobenzenesulfonamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of sodium,N-(benzenesulfonyl)benzenesulfonamide? |
| A: InChIKey of sodium,N-(benzenesulfonyl)benzenesulfonamide is OUDIZSXRGGGZNM-UHFFFAOYSA-N. |
| Q: What English synonyms does sodium,N-(benzenesulfonyl)benzenesulfonamide have? |
| A: English synonyms of sodium,N-(benzenesulfonyl)benzenesulfonamide: sodium dibenzenesulfonimide, N-Phenylsulfonyl-N-sodiobenzenesulfonamide. |
| Q: What is the boiling point of sodium,N-(benzenesulfonyl)benzenesulfonamide? |
| A: Boiling point of sodium,N-(benzenesulfonyl)benzenesulfonamide is 480.6ºC at 760mmHg. |
| Q: What is the SMILES notation of sodium,N-(benzenesulfonyl)benzenesulfonamide? |
| A: SMILES notation of sodium,N-(benzenesulfonyl)benzenesulfonamide is C1=CC=C(C=C1)S(=O)(=O)[N-]S(=O)(=O)C2=CC=CC=C2.[Na+]. |
| Q: What is the English name of sodium,N-(benzenesulfonyl)benzenesulfonamide? |
| A: The English name of sodium,N-(benzenesulfonyl)benzenesulfonamide is sodium,N-(benzenesulfonyl)benzenesulfonamide. |
| Q: What is the LogP of sodium,N-(benzenesulfonyl)benzenesulfonamide? |
| A: LogP of sodium,N-(benzenesulfonyl)benzenesulfonamide is 3.90630. |
| Q: What is the molecular weight of sodium,N-(benzenesulfonyl)benzenesulfonamide? |
| A: Molecular weight of sodium,N-(benzenesulfonyl)benzenesulfonamide is 319.3. |
| Q: What is the molecular formula of sodium,N-(benzenesulfonyl)benzenesulfonamide? |
| A: Molecular formula of sodium,N-(benzenesulfonyl)benzenesulfonamide is C12H10NNaO4S2. |
| Q: What is the polar surface area (PSA) of sodium,N-(benzenesulfonyl)benzenesulfonamide? |
| A: Polar surface area (PSA) of sodium,N-(benzenesulfonyl)benzenesulfonamide is 97.07000. |
| Q: What are the downstream products of sodium,N-(benzenesulfonyl)benzenesulfonamide? |
| A: Related downstream products(CAS) of sodium,N-(benzenesulfonyl)benzenesulfonamide: 94500-78-4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |