4-(2,4,5-Trichlorophenoxy)butanoic acid methyl ester
Modify Date: 2025-08-25 10:33:31
4-(2,4,5-Trichlorophenoxy)butanoic acid methyl ester structure
|
Common Name | 4-(2,4,5-Trichlorophenoxy)butanoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 25333-21-5 | Molecular Weight | 297.56200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11Cl3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-(2,4,5-trichlorophenoxy)butanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11Cl3O3 |
|---|---|
| Molecular Weight | 297.56200 |
| Exact Mass | 295.97700 |
| PSA | 35.53000 |
| LogP | 3.97880 |
| InChIKey | OTBMAATXBNOQHO-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCOc1cc(Cl)c(Cl)cc1Cl |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(2,4,5-Trichlorophenoxy)butanoic acid methyl ester |
| Butyric acid,4-(2,4,5-trichlorophenoxy)-,methyl ester |
| Butanoic acid,4-(2,4,5-trichlorophenoxy)-,methyl ester |