N,N'-dibenzylhexanediamide
N,N'-dibenzylhexanediamide structure
|
Common Name | N,N'-dibenzylhexanediamide | ||
|---|---|---|---|---|
| CAS Number | 25344-24-5 | Molecular Weight | 324.41700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N'-dibenzylhexanediamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H24N2O2 |
|---|---|
| Molecular Weight | 324.41700 |
| Exact Mass | 324.18400 |
| PSA | 65.18000 |
| LogP | 4.86020 |
| InChIKey | MFBKELHPKHLNTH-UHFFFAOYSA-N |
| SMILES | O=C(CCCCC(=O)NCc1ccccc1)NCc1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:30070-99-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-benzyl-N'-benzylhexane-1,6-diamide |
| N,N-Bis(phenylmethyl)hexanediamide |
| UNII-Y359L3Y8LU |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N,N'-dibenzylhexanediamide? |
| A: The English name of N,N'-dibenzylhexanediamide is N,N'-dibenzylhexanediamide. |
| Q: What is the molecular formula of N,N'-dibenzylhexanediamide? |
| A: Molecular formula of N,N'-dibenzylhexanediamide is C20H24N2O2. |
| Q: What is the CAS number of N,N'-dibenzylhexanediamide? |
| A: CAS number of N,N'-dibenzylhexanediamide is 25344-24-5. |
| Q: What is the Chinese name of 25344-24-5? |
| A: Chinese name of 25344-24-5 is 25344-24-5. |
| Q: What are the downstream products of N,N'-dibenzylhexanediamide? |
| A: Related downstream products(CAS) of N,N'-dibenzylhexanediamide: 30070-99-6. |
| Q: What is the polar surface area (PSA) of N,N'-dibenzylhexanediamide? |
| A: Polar surface area (PSA) of N,N'-dibenzylhexanediamide is 65.18000. |
| Q: What is the InChIKey of N,N'-dibenzylhexanediamide? |
| A: InChIKey of N,N'-dibenzylhexanediamide is MFBKELHPKHLNTH-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N,N'-dibenzylhexanediamide? |
| A: SMILES notation of N,N'-dibenzylhexanediamide is O=C(CCCCC(=O)NCc1ccccc1)NCc1ccccc1. |
| Q: What is the molecular weight of N,N'-dibenzylhexanediamide? |
| A: Molecular weight of N,N'-dibenzylhexanediamide is 324.41700. |
| Q: What is the LogP of N,N'-dibenzylhexanediamide? |
| A: LogP of N,N'-dibenzylhexanediamide is 4.86020. |