1,3,5-Trineopentyl-2-iodobenzene structure
|
Common Name | 1,3,5-Trineopentyl-2-iodobenzene | ||
|---|---|---|---|---|
| CAS Number | 25347-04-0 | Molecular Weight | 414.40700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H35I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3,5-tris(2,2-dimethylpropyl)-2-iodobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H35I |
|---|---|
| Molecular Weight | 414.40700 |
| Exact Mass | 414.17800 |
| LogP | 7.05700 |
| InChIKey | QNJSSTJXIKNVHK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)Cc1cc(CC(C)(C)C)c(I)c(CC(C)(C)C)c1 |
| HS Code | 2903999090 |
|---|
|
~%
1,3,5-Trineopen... CAS#:25347-04-0 |
| Literature: Nilsson,B. et al. Journal of the American Chemical Society, 1974 , vol. 96, p. 3190 - 3197 |
|
~%
1,3,5-Trineopen... CAS#:25347-04-0 |
| Literature: Olsson,K. Acta Chemica Scandinavica (1947-1973), 1972 , vol. 26, p. 3555 - 3567 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Iod-1,3,5-trineopentyl-benzol |
| 1,3,5-Trineopentyl-2-iodobenzene |
| Benzene,1,3,5-tris(2,2-dimethylpropyl)-2-iodo |
| 2-Jod-1,3,5-trineopentylbenzol |
| 1-Iod-2,4,6-trineopentylbenzol |
| Benzene,2-iodo-1,3,5-trineopentyl |
| 2-iodo-1,3,5-trineopentylbenzene |