5-(3-Cyanophenyl)-furane-2-carboxylic acid structure
|
Common Name | 5-(3-Cyanophenyl)-furane-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 253679-32-2 | Molecular Weight | 213.18900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(3-cyanophenyl)furan-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H7NO3 |
|---|---|
| Molecular Weight | 213.18900 |
| Exact Mass | 213.04300 |
| PSA | 74.23000 |
| LogP | 2.51648 |
| InChIKey | ZBBYBWMLIOUQRN-UHFFFAOYSA-N |
| SMILES | N#Cc1cccc(-c2ccc(C(=O)O)o2)c1 |
|
~%
5-(3-Cyanopheny... CAS#:253679-32-2 |
| Literature: Denonne, Frederic; Binet, Sophie; Burton, Maggi; Collart, Philippe; Dipesa, Alan; Ganguly, Tanmoy; Giannaras, Alexander; Kumar, Seema; Lewis, Timothy; Maounis, Florence; Nicolas, Jean-Marie; Mansley, Tamsin; Pasau, Patrick; Preda, Dorin; Stebbins, Karin; Volosov, Alexander; Zou, Dong Bioorganic and Medicinal Chemistry Letters, 2007 , vol. 17, # 12 p. 3258 - 3261 |
|
~%
5-(3-Cyanopheny... CAS#:253679-32-2 |
| Literature: Denonne, Frederic; Binet, Sophie; Burton, Maggi; Collart, Philippe; Dipesa, Alan; Ganguly, Tanmoy; Giannaras, Alexander; Kumar, Seema; Lewis, Timothy; Maounis, Florence; Nicolas, Jean-Marie; Mansley, Tamsin; Pasau, Patrick; Preda, Dorin; Stebbins, Karin; Volosov, Alexander; Zou, Dong Bioorganic and Medicinal Chemistry Letters, 2007 , vol. 17, # 12 p. 3258 - 3261 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-(3-Cyanophenyl)-furane-2-carboxylic acid |
| 2-Furancarboxylic acid,5-(3-cyanophenyl) |
| 5-(3-Cyanophenyl)-2-furoic acid |