N-Propylcarbamic acid 2-(carbamoyloxymethyl)-2,3-dimethylpentyl ester structure
|
Common Name | N-Propylcarbamic acid 2-(carbamoyloxymethyl)-2,3-dimethylpentyl ester | ||
|---|---|---|---|---|
| CAS Number | 25385-07-3 | Molecular Weight | 274.35700 | |
| Density | 1.043g/cm3 | Boiling Point | 435.2ºC at 760mmHg | |
| Molecular Formula | C13H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217ºC | |
| Name | [2-(carbamoyloxymethyl)-2,3-dimethylpentyl] N-propylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.043g/cm3 |
|---|---|
| Boiling Point | 435.2ºC at 760mmHg |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.35700 |
| Flash Point | 217ºC |
| Exact Mass | 274.18900 |
| PSA | 95.13000 |
| LogP | 2.98850 |
| Vapour Pressure | 8.89E-08mmHg at 25°C |
| Index of Refraction | 1.466 |
| InChIKey | CHRFQIPAIYEJEP-UHFFFAOYSA-N |
| SMILES | CCCNC(=O)OCC(C)(COC(N)=O)C(C)CC |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,3-Propanediol,2-sec-butyl-2-methyl-,carbamate,propylcarbamate |
| N-Propyl-2-methyl-2-sek.-butyl-1,3-dicarbamoyloxy-propan |
| 2-sec-Butyl-2-methyl-1,3-propanediol carbamate propylcarbamate |
| 2-[(carbamoyloxy)methyl]-2,3-dimethylpentyl propylcarbamate |