N-Propylcarbamic acid β-(carbamoyloxymethyl)-β-methylphenethyl ester structure
|
Common Name | N-Propylcarbamic acid β-(carbamoyloxymethyl)-β-methylphenethyl ester | ||
|---|---|---|---|---|
| CAS Number | 25385-13-1 | Molecular Weight | 294.34600 | |
| Density | 1.14g/cm3 | Boiling Point | 497.6ºC at 760mmHg | |
| Molecular Formula | C15H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.8ºC | |
| Name | (3-carbamoyloxy-2-methyl-2-phenylpropyl) N-propylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 497.6ºC at 760mmHg |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.34600 |
| Flash Point | 254.8ºC |
| Exact Mass | 294.15800 |
| PSA | 95.13000 |
| LogP | 2.89400 |
| Vapour Pressure | 4.86E-10mmHg at 25°C |
| Index of Refraction | 1.52 |
| InChIKey | XOTGIMIAOGYFEM-UHFFFAOYSA-N |
| SMILES | CCCNC(=O)OCC(C)(COC(N)=O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(carbamoyloxy)-2-methyl-2-phenylpropyl propylcarbamate (non-preferred name) |
| 1,3-Propanediol,2-methyl-2-phenyl-,carbamate,propylcarbamate |
| 2-Methyl-2-phenyl-1,3-propanediol carbamate propylcarbamate |
| N-Propyl-2-methyl-2-phenyl-1,3-dicarbamoyloxy-propan |