diethyl-[2-(9-ethylfluorene-9-carbonyl)oxyethyl]azanium,chloride structure
|
Common Name | diethyl-[2-(9-ethylfluorene-9-carbonyl)oxyethyl]azanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 25389-42-8 | Molecular Weight | 373.91600 | |
| Density | N/A | Boiling Point | 461.4ºC at 760mmHg | |
| Molecular Formula | C22H28ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.8ºC | |
| Name | diethyl-[2-(9-ethylfluorene-9-carbonyl)oxyethyl]azanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 461.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C22H28ClNO2 |
| Molecular Weight | 373.91600 |
| Flash Point | 143.8ºC |
| Exact Mass | 373.18100 |
| PSA | 29.54000 |
| LogP | 5.05010 |
| Vapour Pressure | 1.08E-08mmHg at 25°C |
| InChIKey | BDZXRUXEZAOBSG-UHFFFAOYSA-N |
| SMILES | CC[NH+](CC)CCOC(=O)C1(CC)c2ccccc2-c2ccccc21.[Cl-] |
|
~%
diethyl-[2-(9-e... CAS#:25389-42-8 |
| Literature: Burtner; Cusic Journal of the American Chemical Society, 1943 , vol. 65, p. 1582 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 9-ethyl-fluorene-9-carboxylic acid-(2-diethylamino-ethyl ester),hydrochloride |
| 9-Aethyl-fluoren-9-carbonsaeure-(2-diaethylamino-aethylester),Hydrochlorid |
| 9-Aethyl-carbazol-3-sulfonsaeure |
| 9-ethyl-carbazole-3-sulfonic acid |
| 9-ethyl-9H-carbazole-3-sulfonic acid |