succinic acid, compound with L-lysine (1:1) structure
|
Common Name | succinic acid, compound with L-lysine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 25399-74-0 | Molecular Weight | 264.27600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H20N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | butanedioic acid,(2S)-2,6-diaminohexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H20N2O6 |
|---|---|
| Molecular Weight | 264.27600 |
| Exact Mass | 264.13200 |
| PSA | 163.94000 |
| LogP | 0.86370 |
| Vapour Pressure | 1.88E-11mmHg at 25°C |
| InChIKey | BOFNEFKSMURYOG-JEDNCBNOSA-N |
| SMILES | NCCCCC(N)C(=O)O.O=C(O)CCC(=O)O |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Succinic acid,compound with L-lysine (1:1) |