propane-1,2,3-triphosphonic acid structure
|
Common Name | propane-1,2,3-triphosphonic acid | ||
|---|---|---|---|---|
| CAS Number | 25404-72-2 | Molecular Weight | 284.03500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3H11O9P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | propane-1,2,3-triphosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C3H11O9P3 |
|---|---|
| Molecular Weight | 284.03500 |
| Exact Mass | 283.96200 |
| PSA | 259.98000 |
| LogP | 2.12760 |
| InChIKey | SXGRAKNNKBAFML-UHFFFAOYSA-N |
| SMILES | O=P(O)(O)CC(CP(=O)(O)O)P(=O)(O)O |
|
~%
propane-1,2,3-t... CAS#:25404-72-2 |
| Literature: Cilley,W.A. et al. Journal of the American Chemical Society, 1970 , vol. 92, p. 1685 - 1687 |
| Propan-1,2,3-triphosphonsaeure |