Boc-β-HomoThr(Bzl)-OH structure
|
Common Name | Boc-β-HomoThr(Bzl)-OH | ||
|---|---|---|---|---|
| CAS Number | 254101-11-6 | Molecular Weight | 323.38400 | |
| Density | 1.135g/cm3 | Boiling Point | 485.4ºC at 760mmHg | |
| Molecular Formula | C17H25NO5 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 247.4ºC | |
Use of Boc-β-HomoThr(Bzl)-OH(3R,4R)-4-(benzyloxy)-3-((tert-butoxycarbonyl)amino)pentanoic acid is a threonine derivative[1]. |
| Name | BOC-L-β-HOMOTHREONINE(OBZL) |
|---|---|
| Synonym | More Synonyms |
| Description | (3R,4R)-4-(benzyloxy)-3-((tert-butoxycarbonyl)amino)pentanoic acid is a threonine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.135g/cm3 |
|---|---|
| Boiling Point | 485.4ºC at 760mmHg |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.38400 |
| Flash Point | 247.4ºC |
| Exact Mass | 323.17300 |
| PSA | 84.86000 |
| LogP | 3.35060 |
| Vapour Pressure | 3.1E-10mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | FYZBABHQLFFCHH-UHFFFAOYSA-N |
| SMILES | CC(OCc1ccccc1)C(CC(=O)O)NC(=O)OC(C)(C)C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~88%
Boc-β-HomoThr(B... CAS#:254101-11-6 |
| Literature: Gademann, Karl; Ernst, Martin; Seebach, Dieter; Hoyer, Daniel Helvetica Chimica Acta, 2000 , vol. 83, # 1 p. 16 - 33 |
|
~%
Boc-β-HomoThr(B... CAS#:254101-11-6 |
| Literature: Helvetica Chimica Acta, , vol. 83, # 1 p. 16 - 33 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-O-Benzyl-2,3,5-trideoxy-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-D-threo-pentonic acid |
| Boc-beta-Homothr(Bzl)-OH |
| (3R,4R)-4-(benzyloxy)-3-{[(tert-butoxy)carbonyl]amino}pentanoic acid |
| Boc-b-HoThr(Bzl)-OH |
| BOC-THR(OBZL)-(C*CH2)OH |
| Boc-β-HomoThr(Bzl)-OH |