p-Methoxycinnamic acid trimethylsilyl ester structure
|
Common Name | p-Methoxycinnamic acid trimethylsilyl ester | ||
|---|---|---|---|---|
| CAS Number | 25436-23-1 | Molecular Weight | 250.36600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethylsilyl 3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H18O3Si |
|---|---|
| Molecular Weight | 250.36600 |
| Exact Mass | 250.10300 |
| PSA | 35.53000 |
| LogP | 3.08650 |
| InChIKey | YQVAQSPGNGFHAH-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=CC(=O)O[Si](C)(C)C)cc1 |
| HS Code | 2931900090 |
|---|
|
~77%
p-Methoxycinnam... CAS#:25436-23-1 |
| Literature: Bestmann, Hans-Juergen; Dostalek, Roman; Zimmermann, Reiner Chemische Berichte, 1992 , vol. 125, # 9 p. 2081 - 2084 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 3-(4-Methoxyphenyl)-2-propensaeure-trimethylsilylester |
| p-Methoxycinnamic acid trimethylsilyl ester |