4-Chlorobenzoic acid trimethylsilyl ester structure
|
Common Name | 4-Chlorobenzoic acid trimethylsilyl ester | ||
|---|---|---|---|---|
| CAS Number | 25436-27-5 | Molecular Weight | 228.74800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13ClO2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethylsilyl 4-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13ClO2Si |
|---|---|
| Molecular Weight | 228.74800 |
| Exact Mass | 228.03700 |
| PSA | 26.30000 |
| LogP | 3.33170 |
| InChIKey | XGABXNUFKZKQCO-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC(=O)c1ccc(Cl)cc1 |
| HS Code | 2931900090 |
|---|
|
~75%
4-Chlorobenzoic... CAS#:25436-27-5 |
| Literature: Yamamoto, Yasushi; Shimizu, Hideaki; Hamada, Yoshitaka Journal of Organometallic Chemistry, 1996 , vol. 509, # 2 p. 119 - 122 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 4-Chlorobenzoic acid trimethylsilyl ester |
| Benzoic acid,4-chloro-,trimethylsilyl ester |
| Trimethyl-p-chlorbenzoylsilan |
| trimethylsilyl p-chlorobenzoate |
| Benzoic acid,p-chloro-,trimethylsilyl ester |