N,N-dimethyl-2-[(2-phenylacetyl)amino]acetamide structure
|
Common Name | N,N-dimethyl-2-[(2-phenylacetyl)amino]acetamide | ||
|---|---|---|---|---|
| CAS Number | 25439-20-7 | Molecular Weight | 220.26800 | |
| Density | 1.109g/cm3 | Boiling Point | 443.4ºC at 760 mmHg | |
| Molecular Formula | C12H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222ºC | |
| Name | N-[2-(dimethylamino)-2-oxoethyl]-2-phenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.109g/cm3 |
|---|---|
| Boiling Point | 443.4ºC at 760 mmHg |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.26800 |
| Flash Point | 222ºC |
| Exact Mass | 220.12100 |
| PSA | 52.90000 |
| LogP | 1.27380 |
| Vapour Pressure | 4.65E-08mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | OZTTXCISDPJUDI-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CNC(=O)Cc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
N,N-dimethyl-2-... CAS#:25439-20-7 |
| Literature: Beecham Group Ltd. Patent: DE1927692 , 1969 ; Chem.Abstr., 1970 , vol. 72, # 55885 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N-Dimethyl-2-(2-phenylacetamido)acetamide |
| ACETAMIDE,N,N-DIMETHYL-2-(2-PHENYLACETAMIDO) |