3-(diethoxyphosphorylsulfanylmethyl)-5-methyl-1,3,4-oxadiazol-2-one
Modify Date: 2025-09-21 19:07:32
3-(diethoxyphosphorylsulfanylmethyl)-5-methyl-1,3,4-oxadiazol-2-one structure
|
Common Name | 3-(diethoxyphosphorylsulfanylmethyl)-5-methyl-1,3,4-oxadiazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 2544-52-7 | Molecular Weight | 282.25400 | |
| Density | 1.44g/cm3 | Boiling Point | 325.5ºC at 760mmHg | |
| Molecular Formula | C8H15N2O5PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.6ºC | |
| Name | 3-(diethoxyphosphorylsulfanylmethyl)-5-methyl-1,3,4-oxadiazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 325.5ºC at 760mmHg |
| Molecular Formula | C8H15N2O5PS |
| Molecular Weight | 282.25400 |
| Flash Point | 150.6ºC |
| Exact Mass | 282.04400 |
| PSA | 118.67000 |
| LogP | 2.01650 |
| Vapour Pressure | 0.00023mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | BMGRCCNWEFPJON-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)SCn1nc(C)oc1=O |
|
~%
3-(diethoxyphos... CAS#:2544-52-7 |
| Literature: Ruefenacht,K. Helvetica Chimica Acta, 1972 , vol. 55, p. 1174 - 1178 |
![3-chloromethyl-5-methyl-3H-[1,3,4]oxadiazol-2-one structure](https://image.chemsrc.com/caspic/080/1711-85-9.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphorothioic acid,O,O-diethyl ester,S-ester with 3-(mercaptomethyl)-5-methyl-1,3,4-oxadiazol-2(3H)-one |
| thiophosphoric acid O,O'-diethyl ester S-(5-methyl-2-oxo-[1,3,4]oxadiazol-3-ylmethyl) ester |
| O,O-diethyl S-[(5-methyl-2-oxo-1,3,4-oxadiazol-3(2H)-yl)methyl] phosphorothioate |