ethyl N-[(Z)-1-(2,4-dichlorophenyl)ethylideneamino]carbamate structure
|
Common Name | ethyl N-[(Z)-1-(2,4-dichlorophenyl)ethylideneamino]carbamate | ||
|---|---|---|---|---|
| CAS Number | 25445-83-4 | Molecular Weight | 275.13100 | |
| Density | 1.3g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H12Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-[(Z)-1-(2,4-dichlorophenyl)ethylideneamino]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Molecular Formula | C11H12Cl2N2O2 |
| Molecular Weight | 275.13100 |
| Exact Mass | 274.02800 |
| PSA | 54.18000 |
| LogP | 3.66790 |
| Index of Refraction | 1.555 |
| InChIKey | OUGRHYVTDGBCHX-AUWJEWJLSA-N |
| SMILES | CCOC(=O)N/N=C(/C)C1=C(C=C(C=C1)Cl)Cl |
|
~65%
ethyl N-[(Z)-1-... CAS#:25445-83-4 |
| Literature: Cave; Galons; Miocque; Rinjard; Tran; Binet European Journal of Medicinal Chemistry, 1990 , vol. 25, # 1 p. 75 - 79 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4-Dichloracetophenon-carbethoxyhydrazon |
| [1-(2,4-dichloro-phenyl)-ethylidene]-hydrazinecarboxylic acid ethyl ester |
| Hydrazinecarboxylic acid,2-(1-(2,4-dichlorophenyl)ethylidene)-,ethyl ester |