Dihydro α-Ergocryptine
Dihydro α-Ergocryptine structure
|
Common Name | Dihydro α-Ergocryptine | ||
|---|---|---|---|---|
| CAS Number | 25447-66-9 | Molecular Weight | 577.71400 | |
| Density | 1.36g/cm3 | Boiling Point | 848.7ºC at 760 mmHg | |
| Molecular Formula | C32H43N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 467.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dihydro-α-ergocryptine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 848.7ºC at 760 mmHg |
| Molecular Formula | C32H43N5O5 |
| Molecular Weight | 577.71400 |
| Flash Point | 467.1ºC |
| Exact Mass | 577.32600 |
| PSA | 121.70000 |
| LogP | 3.17460 |
| Vapour Pressure | 1.26E-30mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | PBUNVLRHZGSROC-VTIMJTGVSA-N |
| SMILES | CC(C)CC1C(=O)N2CCCC2C2(O)OC(NC(=O)C3CC4c5cccc6[nH]cc(c56)CC4N(C)C3)(C(C)C)C(=O)N12 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 3 | |
CAS#:511-09-1
CAS#:5878-43-3
CAS#:72821-79-5
CAS#:81409-74-7This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Dihydroergokryptine |
| Dihydroergocryptine |
| EINECS 246-993-6 |
| Dihydroergocriptine |
| dihydro-alpha-ergocryptine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of dihydro-α-ergocryptine? |
| A: SMILES notation of dihydro-α-ergocryptine is CC(C)CC1C(=O)N2CCCC2C2(O)OC(NC(=O)C3CC4c5cccc6[nH]cc(c56)CC4N(C)C3)(C(C)C)C(=O)N12. |
| Q: What is the molecular weight of dihydro-α-ergocryptine? |
| A: Molecular weight of dihydro-α-ergocryptine is 577.71400. |
| Q: What is the CAS number of dihydro-α-ergocryptine? |
| A: CAS number of dihydro-α-ergocryptine is 25447-66-9. |
| Q: What English synonyms does dihydro-α-ergocryptine have? |
| A: English synonyms of dihydro-α-ergocryptine: Dihydroergokryptine, Dihydroergocryptine, EINECS 246-993-6, Dihydroergocriptine, dihydro-alpha-ergocryptine. |
| Q: What is the LogP of dihydro-α-ergocryptine? |
| A: LogP of dihydro-α-ergocryptine is 3.17460. |
| Q: What are the downstream products of dihydro-α-ergocryptine? |
| A: Related downstream products(CAS) of dihydro-α-ergocryptine: 5878-43-3;72821-79-5;81409-74-7. |
| Q: What is the polar surface area (PSA) of dihydro-α-ergocryptine? |
| A: Polar surface area (PSA) of dihydro-α-ergocryptine is 121.70000. |
| Q: What is the English name of dihydro-α-ergocryptine? |
| A: The English name of dihydro-α-ergocryptine is dihydro-α-ergocryptine. |
| Q: What is the boiling point of dihydro-α-ergocryptine? |
| A: Boiling point of dihydro-α-ergocryptine is 848.7ºC at 760 mmHg. |
| Q: What is the Chinese name of 25447-66-9? |
| A: Chinese name of 25447-66-9 is 25447-66-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |