Clamoxyquine structure
|
Common Name | Clamoxyquine | ||
|---|---|---|---|---|
| CAS Number | 2545-39-3 | Molecular Weight | 321.84500 | |
| Density | 1.17g/cm3 | Boiling Point | 469.5ºC at 760mmHg | |
| Molecular Formula | C17H24ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.7ºC | |
| Name | Clamoxyquine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 469.5ºC at 760mmHg |
| Molecular Formula | C17H24ClN3O |
| Molecular Weight | 321.84500 |
| Flash Point | 237.7ºC |
| Exact Mass | 321.16100 |
| PSA | 48.39000 |
| LogP | 3.80620 |
| Vapour Pressure | 1.95E-09mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | HOFHLRCDGWSLHX-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCNCc1cc(Cl)c2cccnc2c1O |
| HS Code | 2933499090 |
|---|
|
~%
Clamoxyquine CAS#:2545-39-3 |
| Literature: Parke, Davis and Co. Patent: US2746963 , 1954 ; Full Text Show Details Burckhalter et al. Journal of Organic Chemistry, 1961 , vol. 26, p. 4070,4076 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Chlor-7-[(3-diaethylamino-propylamino)-methyl]-chinolin-8-ol |
| 5-chloro-7-[(3-diethylamino-propylamino)-methyl]-quinolin-8-ol |
| Clamoxyquin |
| 5-Chlor-7-(3-diethylamino-propylaminomethyl)-8-chinolinol |