H-Tyr-Glu-OH structure
|
Common Name | H-Tyr-Glu-OH | ||
|---|---|---|---|---|
| CAS Number | 2545-89-3 | Molecular Weight | 310.30300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]pentanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18N2O6 |
|---|---|
| Molecular Weight | 310.30300 |
| Exact Mass | 310.11600 |
| PSA | 153.44000 |
| LogP | 1.23680 |
| InChIKey | PDSLRCZINIDLMU-QWRGUYRKSA-N |
| SMILES | NC(Cc1ccc(O)cc1)C(=O)NC(CCC(=O)O)C(=O)O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Inhibition of nitrogen-starved wild type sigma1278b yeast Gap1-mediated amino acid up...
Source: ChEMBL
Target: General amino-acid permease GAP1
External Id: CHEMBL1228071
|
| N-L-Tyrosyl-L-glutaminsaeure |
| 2-[2-amino-3-(4-hydroxyphenyl)propanamido]pentanedioic acid |
| TYR-GLU |
| N-L-tyrosyl-L-glutamic acid |
| H-Tyr-Glu-OH |
| L-tyrosyl-L-glutamic acid |
| tyrosylglutamate |
| L-Tyrosyl=>L-glutaminsaeure |