3-Oxobutyric acid 1,5-dimethyl-1-vinyl-4-hexenyl ester structure
|
Common Name | 3-Oxobutyric acid 1,5-dimethyl-1-vinyl-4-hexenyl ester | ||
|---|---|---|---|---|
| CAS Number | 25456-03-5 | Molecular Weight | 238.32300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,7-Dimethylocta-1,6-dien-3-yl acetoacetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H22O3 |
|---|---|
| Molecular Weight | 238.32300 |
| Exact Mass | 238.15700 |
| PSA | 43.37000 |
| LogP | 3.19980 |
| InChIKey | ZANSWOBXLYAUHS-UHFFFAOYSA-N |
| SMILES | C=CC(C)(CCC=C(C)C)OC(=O)CC(C)=O |
| HS Code | 2918300090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Acetessigsaeure-linalylester |
| 3,7-dimethyl-1,6-octadien-3-yl 3-oxo-butyrate |
| Acetessigsaeure-(1,5-dimethyl-1-vinyl-hex-4-enylester) |
| linalyl acetoacetate |
| Linalyl acetoacetate |
| acetoacetic acid-linalyl ester |