2(1H)-Pyrazinone,3-chloro-5,6-diphenyl- structure
|
Common Name | 2(1H)-Pyrazinone,3-chloro-5,6-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 25468-59-1 | Molecular Weight | 282.72400 | |
| Density | 1.28g/cm3 | Boiling Point | 482.7ºC at 760mmHg | |
| Molecular Formula | C16H11ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.7ºC | |
| Name | 3-chloro-5,6-diphenyl-1H-pyrazin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 482.7ºC at 760mmHg |
| Molecular Formula | C16H11ClN2O |
| Molecular Weight | 282.72400 |
| Flash Point | 245.7ºC |
| Exact Mass | 282.05600 |
| PSA | 45.75000 |
| LogP | 3.75730 |
| Vapour Pressure | 6.09E-10mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | LYFGSBZPOGZMFW-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(-c2ccccc2)c(-c2ccccc2)nc1Cl |
|
~56%
2(1H)-Pyrazinon... CAS#:25468-59-1 |
| Literature: Aoyagi, Yutaka; Fujiwara, Takako; Ohta, Akihiro Heterocycles, 1991 , vol. 32, # 12 p. 2407 - 2415 |
|
~%
2(1H)-Pyrazinon... CAS#:25468-59-1 |
| Literature: Martin; Tarasiejska Bulletin des Societes Chimiques Belges, 1957 , vol. 66, p. 136,149 |
|
~%
2(1H)-Pyrazinon... CAS#:25468-59-1 |
| Literature: Karmas; Spoerri Journal of the American Chemical Society, 1956 , vol. 78, p. 4071,4076 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3-Chlor-5,6-diphenyl-1H-pyrazin-2-on |
| 3-chloro-5,6-diphenylpyrazin-2(1h)-one |