2,4(1H,3H)-Pteridinedione,1,3-dimethyl-6-phenyl structure
|
Common Name | 2,4(1H,3H)-Pteridinedione,1,3-dimethyl-6-phenyl | ||
|---|---|---|---|---|
| CAS Number | 25477-76-3 | Molecular Weight | 268.27100 | |
| Density | 1.32g/cm3 | Boiling Point | 475ºC at 760mmHg | |
| Molecular Formula | C14H12N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.1ºC | |
| Name | 1,3-dimethyl-6-phenylpteridine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 475ºC at 760mmHg |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.27100 |
| Flash Point | 241.1ºC |
| Exact Mass | 268.09600 |
| PSA | 69.78000 |
| LogP | 0.69420 |
| Vapour Pressure | 3.45E-09mmHg at 25°C |
| Index of Refraction | 1.62 |
| InChIKey | DKIVATKWMWLPJW-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2nc(-c3ccccc3)cnc2n(C)c1=O |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
|
Name: Ratio of IC50 for aminoguanidine to IC50 for drug for NOS in Sprague-Dawley rat brain...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1064620
|
|
Name: Inhibition of MAOB from baboon liver at 100 uM by spectrophotometry
Source: ChEMBL
Target: N/A
External Id: CHEMBL1064618
|
| 1,3-Dimethyl-6-phenyl-2,4(1H,3H)-pteridindion |
| 1,3-Dimethyl-6-phenylpyrazino<2,3-d>pyrimidine-2,4(1H,3H)-dione |
| 1,3-dimethyl-2,4-dioxo-6-phenyl-1,2,3,4-tetrahydropteridine |
| 6-phenyl-1,3-dimethyllumazine |
| 1,3-dimethyl-6-phenyl-1H-pteridine-2,4-dione |
| 1,3-Dimethyl-6-phenyl-1H-pteridin-2,4-dion |