Benzene,2,4-dinitro-1-(3-nitrophenoxy)- structure
|
Common Name | Benzene,2,4-dinitro-1-(3-nitrophenoxy)- | ||
|---|---|---|---|---|
| CAS Number | 2548-97-2 | Molecular Weight | 305.20000 | |
| Density | 1.56g/cm3 | Boiling Point | 426.5ºC at 760mmHg | |
| Molecular Formula | C12H7N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.5ºC | |
| Name | 2,4-dinitro-1-(3-nitrophenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 426.5ºC at 760mmHg |
| Molecular Formula | C12H7N3O7 |
| Molecular Weight | 305.20000 |
| Flash Point | 189.5ºC |
| Exact Mass | 305.02800 |
| PSA | 146.69000 |
| LogP | 4.77310 |
| Vapour Pressure | 4.38E-07mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | SFBYLUNXRRSEEP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
|
~%
Benzene,2,4-din... CAS#:2548-97-2 |
| Literature: Braeuniger; Spangenberg Pharmazie, 1957 , vol. 12, p. 335,345 Full Text Show Details Reinheimer et al. Journal of Organic Chemistry, 1957 , vol. 22, p. 1743 |
|
~%
Benzene,2,4-din... CAS#:2548-97-2 |
| Literature: Westf.-Anhalt. Sprengstoff-A.-G. Patent: DE281053 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 164 |
| 2,4,3'-Trinitro-diphenyl-ether |
| UNII-72I9A2I712 |
| (2,4-dinitro-phenyl)-(3-nitro-phenyl)-ether |
| 3-Nitro-2',4'-dinitrodiphenylether |
| 2,4-Dinitro-3'-nitrodiphenyl ether |
| (2,4-Dinitro-phenyl)-(3-nitro-phenyl)-aether |
| 2.4.3'-Trinitro-diphenylaether |
| 1-(m-nitrophenoxy)-2,4-dinitrobenzene |