2-[4-(1-methyl-1H-imidazol-4-yl)phenyl]piperidine dihydrochloride
Modify Date: 2025-09-04 08:21:17
![2-[4-(1-methyl-1H-imidazol-4-yl)phenyl]piperidine dihydrochloride Structure](https://www.chemsrc.com/extcaspic/243/2548987-68-2.png)
2-[4-(1-methyl-1H-imidazol-4-yl)phenyl]piperidine dihydrochloride structure
|
Common Name | 2-[4-(1-methyl-1H-imidazol-4-yl)phenyl]piperidine dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2548987-68-2 | Molecular Weight | 314.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[4-(1-methyl-1H-imidazol-4-yl)phenyl]piperidine dihydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H21Cl2N3 |
|---|---|
| Molecular Weight | 314.3 |
| InChIKey | HYJQVYFTGNVIFV-UHFFFAOYSA-N |
| SMILES | Cl.Cl.Cn1cnc(-c2ccc(C3CCCCN3)cc2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-[4-(1-methyl-1H-imidazol-4-yl)phenyl]piperidine dihydrochloride? |
| A: Molecular weight of 2-[4-(1-methyl-1H-imidazol-4-yl)phenyl]piperidine dihydrochloride is 314.3. |
| Q: What is the molecular formula of 2-[4-(1-methyl-1H-imidazol-4-yl)phenyl]piperidine dihydrochloride? |
| A: Molecular formula of 2-[4-(1-methyl-1H-imidazol-4-yl)phenyl]piperidine dihydrochloride is C15H21Cl2N3. |
| Q: What is the English name of 2-[4-(1-methyl-1H-imidazol-4-yl)phenyl]piperidine dihydrochloride? |
| A: The English name of 2-[4-(1-methyl-1H-imidazol-4-yl)phenyl]piperidine dihydrochloride is 2-[4-(1-methyl-1H-imidazol-4-yl)phenyl]piperidine dihydrochloride. |
| Q: What is the Chinese name of 2548987-68-2? |
| A: Chinese name of 2548987-68-2 is 2548987-68-2. |
| Q: What is the InChIKey of 2-[4-(1-methyl-1H-imidazol-4-yl)phenyl]piperidine dihydrochloride? |
| A: InChIKey of 2-[4-(1-methyl-1H-imidazol-4-yl)phenyl]piperidine dihydrochloride is HYJQVYFTGNVIFV-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-[4-(1-methyl-1H-imidazol-4-yl)phenyl]piperidine dihydrochloride? |
| A: SMILES notation of 2-[4-(1-methyl-1H-imidazol-4-yl)phenyl]piperidine dihydrochloride is Cl.Cl.Cn1cnc(-c2ccc(C3CCCCN3)cc2)c1. |
| Q: What is the CAS number of 2-[4-(1-methyl-1H-imidazol-4-yl)phenyl]piperidine dihydrochloride? |
| A: CAS number of 2-[4-(1-methyl-1H-imidazol-4-yl)phenyl]piperidine dihydrochloride is 2548987-68-2. |