4-hydroxyphenylisopropylarterenol structure
|
Common Name | 4-hydroxyphenylisopropylarterenol | ||
|---|---|---|---|---|
| CAS Number | 2549-15-7 | Molecular Weight | 303.35300 | |
| Density | 1.289g/cm3 | Boiling Point | 566ºC at 760mmHg | |
| Molecular Formula | C17H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.1ºC | |
| Name | 4-[1-hydroxy-2-[1-(4-hydroxyphenyl)propan-2-ylamino]ethyl]benzene-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 566ºC at 760mmHg |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.35300 |
| Flash Point | 203.1ºC |
| Exact Mass | 303.14700 |
| PSA | 92.95000 |
| LogP | 2.44850 |
| Vapour Pressure | 1.19E-13mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | IBCZJCQDLOHBPI-UHFFFAOYSA-N |
| SMILES | CC(Cc1ccc(O)cc1)NCC(O)c1ccc(O)c(O)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-{1-Hydroxy-2-[2-(4-hydroxy-phenyl)-1-methyl-aethylamino]-aethyl}-brenzcatechin |
| para-Hydroxyphenylisopropylarterenol |
| 1-(3,4-Dihydroxy-phenyl)-2-[2-(4-hydroxy-phenyl)-1-methyl-aethylamino]-aethanol |
| CC 25 |
| 4-(1-hydroxy-2-{[1-(4-hydroxyphenyl)propan-2-yl]amino}ethyl)benzene-1,2-diol |
| 4-Hydroxyphenylisopropylarterenol |
| Oxyphenudrine |
| 1-(3,4-dihydroxy-phenyl)-2-[2-(4-hydroxy-phenyl)-1-methyl-ethylamino]-ethanol |