dimethyl 2,7-naphthalenedicarboxylate structure
|
Common Name | dimethyl 2,7-naphthalenedicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 2549-47-5 | Molecular Weight | 244.24300 | |
| Density | 1.225g/cm3 | Boiling Point | 375.26ºC at 760 mmHg | |
| Molecular Formula | C14H12O4 | Melting Point | 138ºC | |
| MSDS | N/A | Flash Point | 189.212ºC | |
| Name | dimethyl naphthalene-2,7-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 375.26ºC at 760 mmHg |
| Melting Point | 138ºC |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.24300 |
| Flash Point | 189.212ºC |
| Exact Mass | 244.07400 |
| PSA | 52.60000 |
| LogP | 2.41300 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | WYIBAMPRACRCOM-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2ccc(C(=O)OC)cc2c1 |
| HS Code | 2917399090 |
|---|
|
~85%
dimethyl 2,7-na... CAS#:2549-47-5 |
| Literature: Yao, Zhu-Jun; Ye, Bin; Wu, Xiong-Wu; Wang, Shaomeng; Wu, Li; Zhang, Zhong-Yin; Burke Jr., Terrence R. Bioorganic and Medicinal Chemistry, 1998 , vol. 6, # 10 p. 1799 - 1810 |
|
~52%
dimethyl 2,7-na... CAS#:2549-47-5 |
| Literature: Cometti, Giuseppe; vosel, Annick Du; Francalanci, Franco; Santi, Roberto; Cabri, Walter; Foa, Marco Journal of Organometallic Chemistry, 1993 , vol. 451, # 1.2 p. C13 - C14 |
|
~%
dimethyl 2,7-na... CAS#:2549-47-5 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 6, # 10 p. 1799 - 1810 |
|
~%
dimethyl 2,7-na... CAS#:2549-47-5 |
| Literature: Chemische Berichte, , vol. 40, p. 3260 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| dimethyl 2,7-naphthalenedicarboxylate |
| DiMethyl 2,7-Naphthalenedicarboxylate |
| 2,7-naphthalenedicarboxylic acid dimethyl ester |
| 2,7-dimethoxycarbonyl-naphthalene |
| Naphthalin-2,7-dicarbonsaeure-dimethylester |
| Naphthalene-2-7-dicarboxylic acid dimethyl ester |
| N0684 |