sodium 1-amino-9,10-dihydro-9,10-dioxo-4-o-toluidinoanthracene-2-sulphonate structure
|
Common Name | sodium 1-amino-9,10-dihydro-9,10-dioxo-4-o-toluidinoanthracene-2-sulphonate | ||
|---|---|---|---|---|
| CAS Number | 25492-67-5 | Molecular Weight | 430.40900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H15N2NaO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,1-amino-4-(2-methylanilino)-9,10-dioxoanthracene-2-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H15N2NaO5S |
|---|---|
| Molecular Weight | 430.40900 |
| Exact Mass | 430.06000 |
| PSA | 137.77000 |
| LogP | 4.73530 |
| InChIKey | JUUHQEFCLDKFAL-UHFFFAOYSA-M |
| SMILES | Cc1ccccc1Nc1cc(S(=O)(=O)[O-])c(N)c2c1C(=O)c1ccccc1C2=O.[Na+] |
| HS Code | 2922399090 |
|---|
|
~74%
sodium 1-amino-... CAS#:25492-67-5 |
| Literature: Weyler, Stefanie; Baqi, Younis; Hillmann, Petra; Kaulich, Marko; Hunder, Andrea M.; Mueller, Ingrid A.; Mueller, Christa E. Bioorganic and Medicinal Chemistry Letters, 2008 , vol. 18, # 1 p. 223 - 227 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-Amino-9,10-dioxo-4-o-toluidino-9,10-dihydro-anthracen-2-sulfonsaeure,Natrium-Salz |
| EINECS 247-028-1 |
| Sodium 1-amino-9,10-dihydro-9,10-dioxo-4-o-toluidinoanthracene-2-sulphonate |
| 1-amino-9,10-dioxo-4-o-toluidino-9,10-dihydro-anthracene-2-sulfonic acid,sodium-salt |
| 2-Anthraquinonesulfonic acid,1-amino-4-((2-methylphenyl)amino)-,sodium salt |
| sodium 1-amino-9,10-dihydro-9,10-dioxo-4-o-toluidinoanthracene-2-sulfonate |
| 2-Anthracenesulfonic acid,1-amino-9,10-dihydro-4-((2-methylphenyl)amino)-9,10-dioxo-,monosodium salt |
| sodium 1-amino-4-[(2-methylphenyl)amino]-9,10-dioxo-9,10-dihydroanthracene-2-sulfonate |