2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid
![2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid Structure](https://image.chemsrc.com/caspic/117/25495-75-4.png)
2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid structure
|
Common Name | 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 25495-75-4 | Molecular Weight | 246.28300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14N2O4S |
|---|---|
| Molecular Weight | 246.28300 |
| Exact Mass | 246.06700 |
| PSA | 144.91000 |
| LogP | 0.67320 |
| InChIKey | MIZASGHPGXVQAO-NVMQTXNBSA-N |
| SMILES | CC(O)C(C)(O)C(N)c1nc(C(=O)O)cs1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:25438-22-6
CAS#:89283-79-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Thiazolecarboxylicacid,2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 25495-75-4? |
| A: Chinese name of 25495-75-4 is 25495-75-4. |
| Q: What is the SMILES notation of 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid? |
| A: SMILES notation of 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid is CC(O)C(C)(O)C(N)c1nc(C(=O)O)cs1. |
| Q: What is the CAS number of 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid? |
| A: CAS number of 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid is 25495-75-4. |
| Q: What is the InChIKey of 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid? |
| A: InChIKey of 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid is MIZASGHPGXVQAO-NVMQTXNBSA-N. |
| Q: What are the downstream products of 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid? |
| A: Related downstream products(CAS) of 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid: 25438-22-6;89283-79-4. |
| Q: What is the molecular formula of 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid? |
| A: Molecular formula of 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid is C9H14N2O4S. |
| Q: What English synonyms does 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid have? |
| A: English synonyms of 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid: 4-Thiazolecarboxylicacid,2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]. |
| Q: What is the polar surface area (PSA) of 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid? |
| A: Polar surface area (PSA) of 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid is 144.91000. |
| Q: What is the molecular weight of 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid? |
| A: Molecular weight of 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid is 246.28300. |
| Q: What is the LogP of 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid? |
| A: LogP of 2-[(1S,2S,3R)-1-amino-2,3-dihydroxy-2-methylbutyl]-1,3-thiazole-4-carboxylic acid is 0.67320. |