Tert-butyl N-[[(1S,5R)-4-oxo-1-bicyclo[3.2.0]heptanyl]methyl]carbamate
Modify Date: 2026-08-02 11:53:01
![Tert-butyl N-[[(1S,5R)-4-oxo-1-bicyclo[3.2.0]heptanyl]methyl]carbamate Structure](https://www.chemsrc.com/extcaspic/450/2550996-86-4.png)
Tert-butyl N-[[(1S,5R)-4-oxo-1-bicyclo[3.2.0]heptanyl]methyl]carbamate structure
|
Common Name | Tert-butyl N-[[(1S,5R)-4-oxo-1-bicyclo[3.2.0]heptanyl]methyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 2550996-86-4 | Molecular Weight | 239.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tert-butyl N-[[(1S,5R)-4-oxo-1-bicyclo[3.2.0]heptanyl]methyl]carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H21NO3 |
|---|---|
| Molecular Weight | 239.31 |
| InChIKey | ISMLMWDQZJCALX-TVQRCGJNSA-N |
| SMILES | CC(C)(C)OC(=O)NCC12CCC(=O)C1CC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Tert-butyl N-[[(1S,5R)-4-oxo-1-bicyclo[3.2.0]heptanyl]methyl]carbamate? |
| A: The English name of Tert-butyl N-[[(1S,5R)-4-oxo-1-bicyclo[3.2.0]heptanyl]methyl]carbamate is Tert-butyl N-[[(1S,5R)-4-oxo-1-bicyclo[3.2.0]heptanyl]methyl]carbamate. |
| Q: What is the molecular weight of Tert-butyl N-[[(1S,5R)-4-oxo-1-bicyclo[3.2.0]heptanyl]methyl]carbamate? |
| A: Molecular weight of Tert-butyl N-[[(1S,5R)-4-oxo-1-bicyclo[3.2.0]heptanyl]methyl]carbamate is 239.31. |
| Q: What is the CAS number of Tert-butyl N-[[(1S,5R)-4-oxo-1-bicyclo[3.2.0]heptanyl]methyl]carbamate? |
| A: CAS number of Tert-butyl N-[[(1S,5R)-4-oxo-1-bicyclo[3.2.0]heptanyl]methyl]carbamate is 2550996-86-4. |
| Q: What is the SMILES notation of Tert-butyl N-[[(1S,5R)-4-oxo-1-bicyclo[3.2.0]heptanyl]methyl]carbamate? |
| A: SMILES notation of Tert-butyl N-[[(1S,5R)-4-oxo-1-bicyclo[3.2.0]heptanyl]methyl]carbamate is CC(C)(C)OC(=O)NCC12CCC(=O)C1CC2. |
| Q: What is the molecular formula of Tert-butyl N-[[(1S,5R)-4-oxo-1-bicyclo[3.2.0]heptanyl]methyl]carbamate? |
| A: Molecular formula of Tert-butyl N-[[(1S,5R)-4-oxo-1-bicyclo[3.2.0]heptanyl]methyl]carbamate is C13H21NO3. |
| Q: What is the InChIKey of Tert-butyl N-[[(1S,5R)-4-oxo-1-bicyclo[3.2.0]heptanyl]methyl]carbamate? |
| A: InChIKey of Tert-butyl N-[[(1S,5R)-4-oxo-1-bicyclo[3.2.0]heptanyl]methyl]carbamate is ISMLMWDQZJCALX-TVQRCGJNSA-N. |
| Q: What is the Chinese name of 2550996-86-4? |
| A: Chinese name of 2550996-86-4 is 2550996-86-4. |