(E)-1,1'-Vinylenebis[3-[2-(2-pyridyl)ethyl]urea] structure
|
Common Name | (E)-1,1'-Vinylenebis[3-[2-(2-pyridyl)ethyl]urea] | ||
|---|---|---|---|---|
| CAS Number | 25524-61-2 | Molecular Weight | 354.40600 | |
| Density | 1.215g/cm3 | Boiling Point | 537.4ºC at 760mmHg | |
| Molecular Formula | C18H22N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.8ºC | |
| Name | 1-(2-pyridin-2-ylethyl)-3-[(E)-2-(2-pyridin-2-ylethylcarbamoylamino)ethenyl]urea |
|---|
| Density | 1.215g/cm3 |
|---|---|
| Boiling Point | 537.4ºC at 760mmHg |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.40600 |
| Flash Point | 278.8ºC |
| Exact Mass | 354.18000 |
| PSA | 115.02000 |
| LogP | 2.52200 |
| Vapour Pressure | 1.28E-11mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | DEERCSYBVDFLEY-BUHFOSPRSA-N |
| SMILES | O=C(NC=CNC(=O)NCCc1ccccn1)NCCc1ccccn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |