Spiro[cyclopropane-1,5'-[5H]indene]-3',6',7'-triol,2',3',6',7'-tetrahydro-2'-(hydroxymethyl)-2',4',6'-trimethyl-,(2'S,3'R,6'R,7'R)- structure
|
Common Name | Spiro[cyclopropane-1,5'-[5H]indene]-3',6',7'-triol,2',3',6',7'-tetrahydro-2'-(hydroxymethyl)-2',4',6'-trimethyl-,(2'S,3'R,6'R,7'R)- | ||
|---|---|---|---|---|
| CAS Number | 25532-76-7 | Molecular Weight | 266.33300 | |
| Density | 1.34g/cm3 | Boiling Point | 477.2ºC at 760mmHg | |
| Molecular Formula | C15H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.3ºC | |
| Name | 2-(hydroxymethyl)-2,5,7-trimethylspiro[1,4-dihydroindene-6,1'-cyclopropane]-1,4,5-triol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 477.2ºC at 760mmHg |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.33300 |
| Flash Point | 230.3ºC |
| Exact Mass | 266.15200 |
| PSA | 80.92000 |
| LogP | 0.50810 |
| Vapour Pressure | 4.14E-11mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | WDLVHAUYFXIZMX-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC(C)(CO)C2O)C(O)C(C)(O)C12CC2 |
|
~%
Spiro[cycloprop... CAS#:25532-76-7 |
| Literature: McMorris, Trevor C.; Kelner, Michael J.; Wang, Wen; Estes, Leita A.; Montoya, Mark A.; Taetle, Raymond Journal of Organic Chemistry, 1992 , vol. 57, # 25 p. 6876 - 6883 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Dihydroilludin S |