3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea
3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea structure
|
Common Name | 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea | ||
|---|---|---|---|---|
| CAS Number | 25546-09-2 | Molecular Weight | 214.64900 | |
| Density | 1.37g/cm3 | Boiling Point | 389.7ºC at 760mmHg | |
| Molecular Formula | C9H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.5ºC | |
Summary: 3-(4-Chloro-2-hydroxyphenyl)-1,1-dimethylurea (Chinese name: 3-(4-氯-2-羟基苯基)-1,1-二甲基脲, CAS number: 25546-09-2, molecular formula: C9H11ClN2O2, molecular weight: 214.64900), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 389.7ºC at 760mmHg |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.64900 |
| Flash Point | 189.5ºC |
| Exact Mass | 214.05100 |
| PSA | 56.06000 |
| LogP | 2.15270 |
| Vapour Pressure | 1.25E-06mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | DNSFPBQZUFGMGC-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)Nc1ccc(Cl)cc1O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2924299090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| einecs 247-089-4 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea? |
| A: Molecular formula of 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea is C9H11ClN2O2. |
| Q: What is the InChIKey of 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea? |
| A: InChIKey of 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea is DNSFPBQZUFGMGC-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 25546-09-2? |
| A: Chinese name of 25546-09-2 is 25546-09-2. |
| Q: What is the LogP of 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea? |
| A: LogP of 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea is 2.15270. |
| Q: What is the molecular weight of 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea? |
| A: Molecular weight of 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea is 214.64900. |
| Q: What is the SMILES notation of 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea? |
| A: SMILES notation of 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea is CN(C)C(=O)Nc1ccc(Cl)cc1O. |
| Q: What is the polar surface area (PSA) of 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea? |
| A: Polar surface area (PSA) of 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea is 56.06000. |
| Q: What is the English name of 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea? |
| A: The English name of 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea is 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea. |
| Q: What is the CAS number of 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea? |
| A: CAS number of 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea is 25546-09-2. |
| Q: What is the boiling point of 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea? |
| A: Boiling point of 3-(4-chloro-2-hydroxyphenyl)-1,1-dimethylurea is 389.7ºC at 760mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |