4'-Nitro-α-(1-pyrrolidinylimino)acetophenone structure
|
Common Name | 4'-Nitro-α-(1-pyrrolidinylimino)acetophenone | ||
|---|---|---|---|---|
| CAS Number | 25555-23-1 | Molecular Weight | 247.25000 | |
| Density | 1.32g/cm3 | Boiling Point | 423.2ºC at 760mmHg | |
| Molecular Formula | C12H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.8ºC | |
| Name | 1-(4-nitrophenyl)-2-pyrrolidin-1-yliminoethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 423.2ºC at 760mmHg |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25000 |
| Flash Point | 209.8ºC |
| Exact Mass | 247.09600 |
| PSA | 78.49000 |
| LogP | 2.32020 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | MMISGYGYGXBMMS-UKTHLTGXSA-N |
| SMILES | O=C(C=NN1CCCC1)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2933990090 |
|---|
|
~%
4'-Nitro-α-(1-p... CAS#:25555-23-1 |
| Literature: Brehme, Rainer Chemische Berichte, 1990 , vol. 123, # 10 p. 2039 - 2046 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4-Nitrophenyl)glyoxal-2-tetramethylenhydrazon |
| Acetophenone,4'-nitro-2-(1-pyrrolidinylimino)-(8CI) |
| Ethanone,1-(4-nitrophenyl)-2-(1-pyrrolidinylimino) |