4'-Chloro-α-(piperidinoimino)acetophenone
Modify Date: 2025-08-25 19:43:37
4'-Chloro-α-(piperidinoimino)acetophenone structure
|
Common Name | 4'-Chloro-α-(piperidinoimino)acetophenone | ||
|---|---|---|---|---|
| CAS Number | 25555-30-0 | Molecular Weight | 250.72400 | |
| Density | 1.21g/cm3 | Boiling Point | 382.5ºC at 760mmHg | |
| Molecular Formula | C13H15ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.1ºC | |
| Name | 1-(4-chlorophenyl)-2-piperidin-1-yliminoethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 382.5ºC at 760mmHg |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.72400 |
| Flash Point | 185.1ºC |
| Exact Mass | 250.08700 |
| PSA | 32.67000 |
| LogP | 2.93230 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | RDTPPFFGOCEFPW-XNTDXEJSSA-N |
| SMILES | O=C(C=NN1CCCCC1)c1ccc(Cl)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Acetophenone,4'-chloro-2-(piperidinoimino)-(8CI) |
| Ethanone,1-(4-chlorophenyl)-2-(1-piperidinylimino) |
| 1-(4-chloro-phenyl)-2-piperidin-1-ylimino-ethanone |
| 4'-CHLORO-2-(PIPERIDIN-1-YLIMINO)ACETOPHENONE |