4'-Methyl-α-[(4-methyl-1-piperazinyl)imino]acetophenone structure
|
Common Name | 4'-Methyl-α-[(4-methyl-1-piperazinyl)imino]acetophenone | ||
|---|---|---|---|---|
| CAS Number | 25561-47-1 | Molecular Weight | 245.32000 | |
| Density | 1.1g/cm3 | Boiling Point | 377.7ºC at 760mmHg | |
| Molecular Formula | C14H19N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.3ºC | |
| Name | 1-(4-methylphenyl)-2-(4-methylpiperazin-1-yl)iminoethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 377.7ºC at 760mmHg |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.32000 |
| Flash Point | 182.3ºC |
| Exact Mass | 245.15300 |
| PSA | 35.91000 |
| LogP | 1.28670 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | PLNFNWUUHPIZQJ-RVDMUPIBSA-N |
| SMILES | Cc1ccc(C(=O)C=NN2CCN(C)CC2)cc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethanone,1-(4-methylphenyl)-2-[(4-methyl-1-piperazinyl)imino] |
| 2-(4-methyl-piperazin-1-ylimino)-1-p-tolyl-ethanone |
| 4'-METHYL-2-((4-METHYL-(PIPERAZIN-1-YL))IMINO)ACETOPHENONE |
| Acetophenone,4'-methyl-2-[(4-methyl-1-piperazinyl)imino]-(8CI) |