Artemisone structure
|
Common Name | Artemisone | ||
|---|---|---|---|---|
| CAS Number | 255730-18-8 | Molecular Weight | 401.51800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H31NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ArtemisoneArtemisone (Artemifone) is a potent and semi-synthetic antimalarial, inhibits P. falciparum strains, with a mean IC50 of 0.83 nM[1]. |
| Name | Artemifone |
|---|
| Description | Artemisone (Artemifone) is a potent and semi-synthetic antimalarial, inhibits P. falciparum strains, with a mean IC50 of 0.83 nM[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 0.83 nM (P. falciparum)[1] |
| References |
| Molecular Formula | C19H31NO6S |
|---|---|
| Molecular Weight | 401.51800 |
| Exact Mass | 401.18700 |
| PSA | 82.68000 |
| LogP | 2.59590 |
| InChIKey | FDMUNKXWYMSZIR-NQWKWHCYSA-N |
| SMILES | CC1CCC2C(C)C(N3CCS(=O)(=O)CC3)OC3OC4(C)CCC1C32OO4 |
| Storage condition | 2-8℃ |