Chalcone,4-(dimethylamino)-5'-fluoro-2'-hydroxy- (7CI,8CI) structure
|
Common Name | Chalcone,4-(dimethylamino)-5'-fluoro-2'-hydroxy- (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 2559-04-8 | Molecular Weight | 285.31300 | |
| Density | 1.238g/cm3 | Boiling Point | 478.5ºC at 760mmHg | |
| Molecular Formula | C17H16FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.2ºC | |
| Name | 3-[4-(dimethylamino)phenyl]-1-(5-fluoro-2-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 478.5ºC at 760mmHg |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.31300 |
| Flash Point | 243.2ºC |
| Exact Mass | 285.11700 |
| PSA | 40.54000 |
| LogP | 3.49340 |
| Vapour Pressure | 8.85E-10mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | TUYBADKHDCWVJW-WEVVVXLNSA-N |
| SMILES | CN(C)c1ccc(C=CC(=O)c2cc(F)ccc2O)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-(5-Fluor-2-hydroxy-phenyl)-3-(4-dimethylamino-phenyl)-prop-2-en-on |
| (E)-3-(4-dimethylaminophenyl)-1-(5-fluoro-2-hydroxy-phenyl)prop-2-en-1-one |