N-(4-(Trifluoromethyl)phenyl)pivalamide
N-(4-(Trifluoromethyl)phenyl)pivalamide structure
|
Common Name | N-(4-(Trifluoromethyl)phenyl)pivalamide | ||
|---|---|---|---|---|
| CAS Number | 25617-34-9 | Molecular Weight | 245.24100 | |
| Density | N/A | Boiling Point | 327.7±42.0°C at 760 mmHg | |
| Molecular Formula | C12H14F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide, also known as N-(4-(Trifluoromethyl)phenyl)pivalamide, CAS number 25617-34-9, molecular formula C12H14F3NO, molecular weight 245.24100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 327.7±42.0°C at 760 mmHg |
|---|---|
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24100 |
| Exact Mass | 245.10300 |
| PSA | 29.10000 |
| LogP | 3.76300 |
| InChIKey | ZYJDCZQBRUWWOU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)Nc1ccc(C(F)(F)F)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2924299090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
![N-[2-formyl-4-(trifluoromethyl)phenyl]-2,2-dimethylpropanamide structure](https://image.chemsrc.com/caspic/483/106746-81-0.png)
CAS#:106746-81-0
CAS#:117324-58-0This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(4-trifluoromethylphenyl)-2,2-dimethylpropanamide |
| 2,2-dimethyl-N-(4-trifluoromethylphenyl)propionamide |
| N-[4-(Trifluoromethyl)phenyl]-trimethylacetamide |
| 4-trifluoromethyl-N-pivaloylaniline |
| N-(4-(trifluoromethyl)phenyl)pivalamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide? |
| A: CAS number of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide is 25617-34-9. |
| Q: What is the SMILES notation of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide? |
| A: SMILES notation of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide is CC(C)(C)C(=O)Nc1ccc(C(F)(F)F)cc1. |
| Q: What are the downstream products of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide? |
| A: Related downstream products(CAS) of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide: 106746-81-0;117324-58-0. |
| Q: What English synonyms does 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide have? |
| A: English synonyms of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide: N-(4-trifluoromethylphenyl)-2,2-dimethylpropanamide, 2,2-dimethyl-N-(4-trifluoromethylphenyl)propionamide, N-[4-(Trifluoromethyl)phenyl]-trimethylacetamide, 4-trifluoromethyl-N-pivaloylaniline, N-(4-(trifluoromethyl)phenyl)pivalamide. |
| Q: What is the LogP of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide? |
| A: LogP of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide is 3.76300. |
| Q: What is the English name of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide? |
| A: The English name of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide is 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide. |
| Q: What is the boiling point of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide? |
| A: Boiling point of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide is 327.7±42.0°C at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide? |
| A: Polar surface area (PSA) of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide is 29.10000. |
| Q: What is the molecular formula of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide? |
| A: Molecular formula of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide is C12H14F3NO. |
| Q: What is the InChIKey of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide? |
| A: InChIKey of 2,2-dimethyl-N-(4-trifluoromethylphenyl)propanamide is ZYJDCZQBRUWWOU-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |