1-(2,3,4,5,6-Pentafluorophenyl)-1-propanol structure
|
Common Name | 1-(2,3,4,5,6-Pentafluorophenyl)-1-propanol | ||
|---|---|---|---|---|
| CAS Number | 25622-74-6 | Molecular Weight | 226.14300 | |
| Density | 1.430 g/mL at 25ºC(lit.) | Boiling Point | 199ºC(lit.) | |
| Molecular Formula | C9H7F5O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 218 °F | |
| Name | 1-(2,3,4,5,6-pentafluorophenyl)propan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.430 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 199ºC(lit.) |
| Molecular Formula | C9H7F5O |
| Molecular Weight | 226.14300 |
| Flash Point | 218 °F |
| Exact Mass | 226.04200 |
| PSA | 20.23000 |
| LogP | 2.82550 |
| Vapour Pressure | 0.338mmHg at 25°C |
| Index of Refraction | n20/D 1.4430(lit.) |
| InChIKey | QRHBGWMLUAGPNM-UHFFFAOYSA-N |
| SMILES | CCC(O)c1c(F)c(F)c(F)c(F)c1F |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2906299090 |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1-Pentafluorphenyl-propan-1-ol |
| 1-pentafluorophenylpropanol |
| 1-Pentafluorphenylpropanol |
| 1-(2,3,4,5,6-Pentafluorophenyl)-1-propanol |
| MFCD03427133 |