4,4',4''-Methylidynetrisphenol structure
|
Common Name | 4,4',4''-Methylidynetrisphenol | ||
|---|---|---|---|---|
| CAS Number | 25639-41-2 | Molecular Weight | 292.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4',4''-Methylidynetrisphenol |
|---|
| Molecular Formula | C19H16O3 |
|---|---|
| Molecular Weight | 292.3 |
| InChIKey | WFCQTAXSWSWIHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O)O |
|
Name: Inhibition of Mycobacterium tuberculosis RmlD assessed as inhibition of dTDP-beta-6-d...
Source: ChEMBL
Target: dTDP-4-dehydrorhamnose reductase
External Id: CHEMBL1942015
|