4,4',4''-Methylidynetrisphenol
Modify Date: 2026-06-16 09:15:20
4,4',4''-Methylidynetrisphenol structure
|
Common Name | 4,4',4''-Methylidynetrisphenol | ||
|---|---|---|---|---|
| CAS Number | 25639-41-2 | Molecular Weight | 292.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4',4''-Methylidynetrisphenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H16O3 |
|---|---|
| Molecular Weight | 292.3 |
| InChIKey | WFCQTAXSWSWIHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of Mycobacterium tuberculosis RmlD assessed as inhibition of dTDP-beta-6-d...
Source: ChEMBL
Target: dTDP-4-dehydrorhamnose reductase
External Id: CHEMBL1942015
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4,4',4''-Methylidynetrisphenol? |
| A: The English name of 4,4',4''-Methylidynetrisphenol is 4,4',4''-Methylidynetrisphenol. |
| Q: What is the InChIKey of 4,4',4''-Methylidynetrisphenol? |
| A: InChIKey of 4,4',4''-Methylidynetrisphenol is WFCQTAXSWSWIHS-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 25639-41-2? |
| A: Chinese name of 25639-41-2 is 25639-41-2. |
| Q: What is the SMILES notation of 4,4',4''-Methylidynetrisphenol? |
| A: SMILES notation of 4,4',4''-Methylidynetrisphenol is C1=CC(=CC=C1C(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O)O. |
| Q: What is the molecular formula of 4,4',4''-Methylidynetrisphenol? |
| A: Molecular formula of 4,4',4''-Methylidynetrisphenol is C19H16O3. |
| Q: What is the molecular weight of 4,4',4''-Methylidynetrisphenol? |
| A: Molecular weight of 4,4',4''-Methylidynetrisphenol is 292.3. |
| Q: What is the CAS number of 4,4',4''-Methylidynetrisphenol? |
| A: CAS number of 4,4',4''-Methylidynetrisphenol is 25639-41-2. |