BENZOTHIAZOLE, 2-(1H-PYRAZOL-3-YL)- (9CI) structure
|
Common Name | BENZOTHIAZOLE, 2-(1H-PYRAZOL-3-YL)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 256414-72-9 | Molecular Weight | 201.24800 | |
| Density | 1.406g/cm3 | Boiling Point | 444.7ºC at 760mmHg | |
| Molecular Formula | C10H7N3S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 225.4ºC | |
| Name | 2-(1H-pyrazol-5-yl)-1,3-benzothiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.406g/cm3 |
|---|---|
| Boiling Point | 444.7ºC at 760mmHg |
| Molecular Formula | C10H7N3S |
| Molecular Weight | 201.24800 |
| Flash Point | 225.4ºC |
| Exact Mass | 201.03600 |
| PSA | 69.81000 |
| LogP | 2.68640 |
| Vapour Pressure | 1.09E-07mmHg at 25°C |
| Index of Refraction | 1.739 |
| InChIKey | YAMYGQRUEXYQIE-UHFFFAOYSA-N |
| SMILES | c1ccc2sc(-c3ccn[nH]3)nc2c1 |
| HS Code | 2934200090 |
|---|
| HS Code | 2934200090 |
|---|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(1H-Pyrazol-5-yl)benzo[d]thiazole |
| 2-pyrazol-3-ylbenzothiazole |
| MFCD01934517 |