6,7-Dimethoxy-4-(pyridin-4-ylmethyl)-1,2-dihydrophthalazine
Modify Date: 2026-07-01 15:46:56
6,7-Dimethoxy-4-(pyridin-4-ylmethyl)-1,2-dihydrophthalazine structure
|
Common Name | 6,7-Dimethoxy-4-(pyridin-4-ylmethyl)-1,2-dihydrophthalazine | ||
|---|---|---|---|---|
| CAS Number | 256421-73-5 | Molecular Weight | 283.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6,7-Dimethoxy-4-(pyridin-4-ylmethyl)-1,2-dihydrophthalazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H17N3O2 |
|---|---|
| Molecular Weight | 283.32 |
| InChIKey | OOZMFTFGQMRMKK-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)C(Cc1ccncc1)=NNC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 6,7-Dimethoxy-4-(pyridin-4-ylmethyl)-1,2-dihydrophthalazine? |
| A: The English name of 6,7-Dimethoxy-4-(pyridin-4-ylmethyl)-1,2-dihydrophthalazine is 6,7-Dimethoxy-4-(pyridin-4-ylmethyl)-1,2-dihydrophthalazine. |
| Q: What is the molecular weight of 6,7-Dimethoxy-4-(pyridin-4-ylmethyl)-1,2-dihydrophthalazine? |
| A: Molecular weight of 6,7-Dimethoxy-4-(pyridin-4-ylmethyl)-1,2-dihydrophthalazine is 283.32. |
| Q: What is the molecular formula of 6,7-Dimethoxy-4-(pyridin-4-ylmethyl)-1,2-dihydrophthalazine? |
| A: Molecular formula of 6,7-Dimethoxy-4-(pyridin-4-ylmethyl)-1,2-dihydrophthalazine is C16H17N3O2. |
| Q: What is the InChIKey of 6,7-Dimethoxy-4-(pyridin-4-ylmethyl)-1,2-dihydrophthalazine? |
| A: InChIKey of 6,7-Dimethoxy-4-(pyridin-4-ylmethyl)-1,2-dihydrophthalazine is OOZMFTFGQMRMKK-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 256421-73-5? |
| A: Chinese name of 256421-73-5 is 256421-73-5. |
| Q: What is the CAS number of 6,7-Dimethoxy-4-(pyridin-4-ylmethyl)-1,2-dihydrophthalazine? |
| A: CAS number of 6,7-Dimethoxy-4-(pyridin-4-ylmethyl)-1,2-dihydrophthalazine is 256421-73-5. |
| Q: What is the SMILES notation of 6,7-Dimethoxy-4-(pyridin-4-ylmethyl)-1,2-dihydrophthalazine? |
| A: SMILES notation of 6,7-Dimethoxy-4-(pyridin-4-ylmethyl)-1,2-dihydrophthalazine is COc1cc2c(cc1OC)C(Cc1ccncc1)=NNC2. |