Bis(N,N-diethylcarbamic acid)2-methyl-2-propyltrimethylene ester structure
|
Common Name | Bis(N,N-diethylcarbamic acid)2-methyl-2-propyltrimethylene ester | ||
|---|---|---|---|---|
| CAS Number | 25648-78-6 | Molecular Weight | 330.46300 | |
| Density | 0.999g/cm3 | Boiling Point | 412.1ºC at 760 mmHg | |
| Molecular Formula | C17H34N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203ºC | |
| Name | [2-(diethylcarbamoyloxymethyl)-2-methylpentyl] N,N-diethylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.999g/cm3 |
|---|---|
| Boiling Point | 412.1ºC at 760 mmHg |
| Molecular Formula | C17H34N2O4 |
| Molecular Weight | 330.46300 |
| Flash Point | 203ºC |
| Exact Mass | 330.25200 |
| PSA | 59.08000 |
| LogP | 3.74960 |
| Vapour Pressure | 5.31E-07mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | ZAGQHNDTRBHZTO-UHFFFAOYSA-N |
| SMILES | CCCC(C)(COC(=O)N(CC)CC)COC(=O)N(CC)CC |
| HS Code | 2924199090 |
|---|
|
~%
Bis(N,N-diethyl... CAS#:25648-78-6 |
| Literature: Cherbuliez,E. et al. Helvetica Chimica Acta, 1961 , vol. 44, p. 1806 - 1809 |
|
~%
Bis(N,N-diethyl... CAS#:25648-78-6 |
| Literature: Ludwig,B.J. et al. Journal of Medicinal Chemistry, 1969 , vol. 12, # 3 p. 462 - 472 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Methyl-2-propyl-1,3-propanediol bis(diethylcarbamate) |
| N.N.N'.N'-Tetraethyl-2-methyl-2-propyl-1.3-dicarbamoyloxy-propan |
| 1,3-Bis-diethylcarbamoyloxy-2-methyl-2-propyl-propan |
| 2-{[(diethylcarbamoyl)oxy]methyl}-2-methylpentyl diethylcarbamate |
| 1,3-Propanediol,2-methyl-2-propyl-,bis(diethylcarbamate) |