3-Isopropylcarbazic acid 2-(hydroxymethyl)-2-methylhexyl ester
Modify Date: 2025-10-12 15:01:17
3-Isopropylcarbazic acid 2-(hydroxymethyl)-2-methylhexyl ester structure
|
Common Name | 3-Isopropylcarbazic acid 2-(hydroxymethyl)-2-methylhexyl ester | ||
|---|---|---|---|---|
| CAS Number | 25649-04-1 | Molecular Weight | 246.34600 | |
| Density | 1.002g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H26N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-(hydroxymethyl)-2-methylhexyl] N-(propan-2-ylamino)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.002g/cm3 |
|---|---|
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.34600 |
| Exact Mass | 246.19400 |
| PSA | 74.08000 |
| LogP | 2.40970 |
| Index of Refraction | 1.466 |
| InChIKey | WUAAJHKTLJWUPX-UHFFFAOYSA-N |
| SMILES | CCCCC(C)(CO)COC(=O)NNC(C)C |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Methyl-2-butyl-3-isopropylaminocarbamoyloxy-propanol-(1) |
| 2-Butyl-2-methyl-1,3-propanediol isopropylaminocarbamate |
| 2-(hydroxymethyl)-2-methylhexyl 2-(propan-2-yl)hydrazinecarboxylate |
| 1,3-Propanediol,2-butyl-2-methyl-,isopropylaminocarbamate |