[3-(methoxymethylcarbamoyloxy)-2,4-dimethylpentyl] N-(methoxymethyl)carbamate structure
|
Common Name | [3-(methoxymethylcarbamoyloxy)-2,4-dimethylpentyl] N-(methoxymethyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 25652-09-9 | Molecular Weight | 306.35500 | |
| Density | 1.088g/cm3 | Boiling Point | 430.5ºC at 760 mmHg | |
| Molecular Formula | C13H26N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.2ºC | |
| Name | [3-(methoxymethylcarbamoyloxy)-2,4-dimethylpentyl] N-(methoxymethyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.088g/cm3 |
|---|---|
| Boiling Point | 430.5ºC at 760 mmHg |
| Molecular Formula | C13H26N2O6 |
| Molecular Weight | 306.35500 |
| Flash Point | 214.2ºC |
| Exact Mass | 306.17900 |
| PSA | 102.10000 |
| LogP | 1.71610 |
| Vapour Pressure | 1.29E-07mmHg at 25°C |
| Index of Refraction | 1.454 |
| InChIKey | WFEQMMMFROHLFX-UHFFFAOYSA-N |
| SMILES | COCNC(=O)OCC(C)C(OC(=O)NCOC)C(C)C |
|
~%
[3-(methoxymeth... CAS#:25652-09-9 |
| Literature: Ludwig,B.J. et al. Journal of Medicinal Chemistry, 1969 , vol. 12, # 3 p. 462 - 472 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,4-dimethylpentane-1,3-diyl bis[(methoxymethyl)carbamate] |
| Carbamic acid,(methoxymethyl)-,2-methyl-2-propyltrimethylene ester |
| (Methoxymethyl)carbamic acid 2-methyl-2-propyltrimethylene ester |
| N,N'-Dimethoxy-N,N',2-trimethyl-2-propyl-1,3-dicarbamoyloxy-propan |